C15H17BrN3OS+ — CID 9180582
(5-bromo-3-pyridinyl)-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]methanone (PubChem CID 9180582) has the molecular formula C15H17BrN3OS+ and a molecular weight of 367.29 g/mol. Its IUPAC name is (5-bromo-3-pyridinyl)-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]methanone.
| Compound Name | (5-bromo-3-pyridinyl)-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 9180582 |
| Molecular Formula | C15H17BrN3OS+ |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | (5-bromo-3-pyridinyl)-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]methanone |
| SMILES | O=C(c1cncc(Br)c1)N1CC[NH+](Cc2ccsc2)CC1 |
| InChI | InChI=1S/C15H16BrN3OS/c16-14-7-13(8-17-9-14)15(20)19-4-2-18(3-5-19)10-12-1-6-21-11-12/h1,6-9,11H,2-5,10H2/p+1 |
| InChIKey | QFQJKYMOYJCUIG-UHFFFAOYSA-O |
| XLogP | 1.45 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |