C16H18BrN4O+ — CID 9226069
(5-bromo-3-pyridinyl)-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]methanone (PubChem CID 9226069) has the molecular formula C16H18BrN4O+ and a molecular weight of 362.25 g/mol. Its IUPAC name is (5-bromo-3-pyridinyl)-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]methanone.
| Compound Name | (5-bromo-3-pyridinyl)-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 9226069 |
| Molecular Formula | C16H18BrN4O+ |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | (5-bromo-3-pyridinyl)-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]methanone |
| SMILES | O=C(c1cncc(Br)c1)N1CC[NH+](Cc2ccncc2)CC1 |
| InChI | InChI=1S/C16H17BrN4O/c17-15-9-14(10-19-11-15)16(22)21-7-5-20(6-8-21)12-13-1-3-18-4-2-13/h1-4,9-11H,5-8,12H2/p+1 |
| InChIKey | KAVLGMQXWDIGDP-UHFFFAOYSA-O |
| XLogP | 0.78 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |