C21H24ClN4O2+ — CID 9226697
1-[2-chloro-5-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-carbonyl]phenyl]pyrrolidin-2-one (PubChem CID 9226697) has the molecular formula C21H24ClN4O2+ and a molecular weight of 399.90 g/mol. Its IUPAC name is 1-[2-chloro-5-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-carbonyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[2-chloro-5-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-carbonyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 9226697 |
| Molecular Formula | C21H24ClN4O2+ |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 1-[2-chloro-5-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-carbonyl]phenyl]pyrrolidin-2-one |
| SMILES | O=C(c1ccc(Cl)c(N2CCCC2=O)c1)N1CC[NH+](Cc2ccncc2)CC1 |
| InChI | InChI=1S/C21H23ClN4O2/c22-18-4-3-17(14-19(18)26-9-1-2-20(26)27)21(28)25-12-10-24(11-13-25)15-16-5-7-23-8-6-16/h3-8,14H,1-2,9-13,15H2/p+1 |
| InChIKey | PRNBVYVFHCYYQV-UHFFFAOYSA-O |
| XLogP | 1.40 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |