C22H26N3O2+ — CID 7964634
1-[4-(4-benzylpiperazin-4-ium-1-carbonyl)phenyl]pyrrolidin-2-one (PubChem CID 7964634) has the molecular formula C22H26N3O2+ and a molecular weight of 364.47 g/mol. Its IUPAC name is 1-[4-(4-benzylpiperazin-4-ium-1-carbonyl)phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-(4-benzylpiperazin-4-ium-1-carbonyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 7964634 |
| Molecular Formula | C22H26N3O2+ |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-[4-(4-benzylpiperazin-4-ium-1-carbonyl)phenyl]pyrrolidin-2-one |
| SMILES | O=C(c1ccc(N2CCCC2=O)cc1)N1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H25N3O2/c26-21-7-4-12-25(21)20-10-8-19(9-11-20)22(27)24-15-13-23(14-16-24)17-18-5-2-1-3-6-18/h1-3,5-6,8-11H,4,7,12-17H2/p+1 |
| InChIKey | AYOUUMBNAIVLTD-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |