C16H22N3O2+ — CID 7446641
1-[4-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]pyrrolidin-2-one (PubChem CID 7446641) has the molecular formula C16H22N3O2+ and a molecular weight of 288.37 g/mol. Its IUPAC name is 1-[4-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 7446641 |
| Molecular Formula | C16H22N3O2+ |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1-[4-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]pyrrolidin-2-one |
| SMILES | C[NH+]1CCN(C(=O)c2ccc(N3CCCC3=O)cc2)CC1 |
| InChI | InChI=1S/C16H21N3O2/c1-17-9-11-18(12-10-17)16(21)13-4-6-14(7-5-13)19-8-2-3-15(19)20/h4-7H,2-3,8-12H2,1H3/p+1 |
| InChIKey | LIVVUXHYXGISFG-UHFFFAOYSA-O |
| XLogP | -0.22 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |