C14H16N2O2S — CID 29184328
1-[4-(1,3-thiazolidine-3-carbonyl)phenyl]pyrrolidin-2-one (PubChem CID 29184328) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 1-[4-(1,3-thiazolidine-3-carbonyl)phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-(1,3-thiazolidine-3-carbonyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 29184328 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 1-[4-(1,3-thiazolidine-3-carbonyl)phenyl]pyrrolidin-2-one |
| SMILES | O=C(c1ccc(N2CCCC2=O)cc1)N1CCSC1 |
| InChI | InChI=1S/C14H16N2O2S/c17-13-2-1-7-16(13)12-5-3-11(4-6-12)14(18)15-8-9-19-10-15/h3-6H,1-2,7-10H2 |
| InChIKey | PGHXEWCSSHETSB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |