C23H27N2O2+ — CID 6982704
(4-benzylpiperazin-4-ium-1-yl)-[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methanone (PubChem CID 6982704) has the molecular formula C23H27N2O2+ and a molecular weight of 363.48 g/mol. Its IUPAC name is (4-benzylpiperazin-4-ium-1-yl)-[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methanone.
| Compound Name | (4-benzylpiperazin-4-ium-1-yl)-[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methanone |
|---|---|
| PubChem CID | 6982704 |
| Molecular Formula | C23H27N2O2+ |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | (4-benzylpiperazin-4-ium-1-yl)-[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methanone |
| SMILES | CC(C)(O)C#Cc1ccc(C(=O)N2CC[NH+](Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H26N2O2/c1-23(2,27)13-12-19-8-10-21(11-9-19)22(26)25-16-14-24(15-17-25)18-20-6-4-3-5-7-20/h3-11,27H,14-18H2,1-2H3/p+1 |
| InChIKey | HASZGJKPUNJCLQ-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 44.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|