C17H18BrClN3O+ — CID 8642811
(5-bromo-3-pyridinyl)-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]methanone (PubChem CID 8642811) has the molecular formula C17H18BrClN3O+ and a molecular weight of 395.71 g/mol. Its IUPAC name is (5-bromo-3-pyridinyl)-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]methanone.
| Compound Name | (5-bromo-3-pyridinyl)-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 8642811 |
| Molecular Formula | C17H18BrClN3O+ |
| Molecular Weight | 395.71 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | (5-bromo-3-pyridinyl)-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]methanone |
| SMILES | O=C(c1cncc(Br)c1)N1CC[NH+](Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H17BrClN3O/c18-15-9-14(10-20-11-15)17(23)22-6-4-21(5-7-22)12-13-2-1-3-16(19)8-13/h1-3,8-11H,4-7,12H2/p+1 |
| InChIKey | AZDDKRLWHCQHTR-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.71 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |