C19H24N3O2+ — CID 4741479
[4-[(4-ethoxyphenyl)methyl]piperazin-4-ium-1-yl]-pyridin-4-ylmethanone (PubChem CID 4741479) has the molecular formula C19H24N3O2+ and a molecular weight of 326.42 g/mol. Its IUPAC name is [4-[(4-ethoxyphenyl)methyl]piperazin-4-ium-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [4-[(4-ethoxyphenyl)methyl]piperazin-4-ium-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 4741479 |
| Molecular Formula | C19H24N3O2+ |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [4-[(4-ethoxyphenyl)methyl]piperazin-4-ium-1-yl]-pyridin-4-ylmethanone |
| SMILES | CCOc1ccc(C[NH+]2CCN(C(=O)c3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C19H23N3O2/c1-2-24-18-5-3-16(4-6-18)15-21-11-13-22(14-12-21)19(23)17-7-9-20-10-8-17/h3-10H,2,11-15H2,1H3/p+1 |
| InChIKey | IKDLLEYZEKGDTG-UHFFFAOYSA-O |
| XLogP | 1.02 |
| TPSA | 46.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |