C18H29N3O2+2 — CID 7368546
(4-ethylpiperazin-4-ium-1-yl)-[4-(morpholin-4-ium-4-ylmethyl)phenyl]methanone (PubChem CID 7368546) has the molecular formula C18H29N3O2+2 and a molecular weight of 319.45 g/mol. Its IUPAC name is (4-ethylpiperazin-4-ium-1-yl)-[4-(morpholin-4-ium-4-ylmethyl)phenyl]methanone.
| Compound Name | (4-ethylpiperazin-4-ium-1-yl)-[4-(morpholin-4-ium-4-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 7368546 |
| Molecular Formula | C18H29N3O2+2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.22 |
| IUPAC Name | (4-ethylpiperazin-4-ium-1-yl)-[4-(morpholin-4-ium-4-ylmethyl)phenyl]methanone |
| SMILES | CC[NH+]1CCN(C(=O)c2ccc(C[NH+]3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C18H27N3O2/c1-2-19-7-9-21(10-8-19)18(22)17-5-3-16(4-6-17)15-20-11-13-23-14-12-20/h3-6H,2,7-15H2,1H3/p+2 |
| InChIKey | NFJDBIJKJOLKRQ-UHFFFAOYSA-P |
| XLogP | -1.54 |
| TPSA | 38.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |