C23H30N3O4S+ — CID 2496345
(4-benzylpiperazin-4-ium-1-yl)-(4-methyl-3-morpholin-4-ylsulfonylphenyl)methanone (PubChem CID 2496345) has the molecular formula C23H30N3O4S+ and a molecular weight of 444.58 g/mol. Its IUPAC name is (4-benzylpiperazin-4-ium-1-yl)-(4-methyl-3-morpholin-4-ylsulfonylphenyl)methanone.
| Compound Name | (4-benzylpiperazin-4-ium-1-yl)-(4-methyl-3-morpholin-4-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 2496345 |
| Molecular Formula | C23H30N3O4S+ |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (4-benzylpiperazin-4-ium-1-yl)-(4-methyl-3-morpholin-4-ylsulfonylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CC[NH+](Cc3ccccc3)CC2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C23H29N3O4S/c1-19-7-8-21(17-22(19)31(28,29)26-13-15-30-16-14-26)23(27)25-11-9-24(10-12-25)18-20-5-3-2-4-6-20/h2-8,17H,9-16,18H2,1H3/p+1 |
| InChIKey | LKBBZGLHTKCORT-UHFFFAOYSA-O |
| XLogP | 0.56 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |