C20H27N2O2S+ — CID 6980440
1-benzyl-4-(2,3,4-trimethylphenyl)sulfonylpiperazin-1-ium (PubChem CID 6980440) has the molecular formula C20H27N2O2S+ and a molecular weight of 359.52 g/mol. Its IUPAC name is 1-benzyl-4-(2,3,4-trimethylphenyl)sulfonylpiperazin-1-ium.
| Compound Name | 1-benzyl-4-(2,3,4-trimethylphenyl)sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 6980440 |
| Molecular Formula | C20H27N2O2S+ |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-benzyl-4-(2,3,4-trimethylphenyl)sulfonylpiperazin-1-ium |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[NH+](Cc3ccccc3)CC2)c(C)c1C |
| InChI | InChI=1S/C20H26N2O2S/c1-16-9-10-20(18(3)17(16)2)25(23,24)22-13-11-21(12-14-22)15-19-7-5-4-6-8-19/h4-10H,11-15H2,1-3H3/p+1 |
| InChIKey | BIPHBSRVVHVJPN-UHFFFAOYSA-O |
| XLogP | 1.70 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |