C20H24N3O3S+ — CID 9186076
(3R)-5-(4-benzylpiperazin-4-ium-1-yl)sulfonyl-3-methyl-1,3-dihydroindol-2-one (PubChem CID 9186076) has the molecular formula C20H24N3O3S+ and a molecular weight of 386.50 g/mol. Its IUPAC name is (3R)-5-(4-benzylpiperazin-4-ium-1-yl)sulfonyl-3-methyl-1,3-dihydroindol-2-one.
| Compound Name | (3R)-5-(4-benzylpiperazin-4-ium-1-yl)sulfonyl-3-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 9186076 |
| Molecular Formula | C20H24N3O3S+ |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (3R)-5-(4-benzylpiperazin-4-ium-1-yl)sulfonyl-3-methyl-1,3-dihydroindol-2-one |
| SMILES | C[C@H]1C(=O)Nc2ccc(S(=O)(=O)N3CC[NH+](Cc4ccccc4)CC3)cc21 |
| InChI | InChI=1S/C20H23N3O3S/c1-15-18-13-17(7-8-19(18)21-20(15)24)27(25,26)23-11-9-22(10-12-23)14-16-5-3-2-4-6-16/h2-8,13,15H,9-12,14H2,1H3,(H,21,24)/p+1/t15-/m1/s1 |
| InChIKey | DSAFVXUCYIISCW-OAHLLOKOSA-O |
| XLogP | 0.83 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |