C19H22N3O2S2+ — CID 9286719
2-[4-[(4-methylsulfanylphenyl)methyl]piperazin-4-ium-1-yl]sulfonylbenzonitrile (PubChem CID 9286719) has the molecular formula C19H22N3O2S2+ and a molecular weight of 388.54 g/mol. Its IUPAC name is 2-[4-[(4-methylsulfanylphenyl)methyl]piperazin-4-ium-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[(4-methylsulfanylphenyl)methyl]piperazin-4-ium-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 9286719 |
| Molecular Formula | C19H22N3O2S2+ |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-[4-[(4-methylsulfanylphenyl)methyl]piperazin-4-ium-1-yl]sulfonylbenzonitrile |
| SMILES | CSc1ccc(C[NH+]2CCN(S(=O)(=O)c3ccccc3C#N)CC2)cc1 |
| InChI | InChI=1S/C19H21N3O2S2/c1-25-18-8-6-16(7-9-18)15-21-10-12-22(13-11-21)26(23,24)19-5-3-2-4-17(19)14-20/h2-9H,10-13,15H2,1H3/p+1 |
| InChIKey | CWNUEQACCMXSLN-UHFFFAOYSA-O |
| XLogP | 1.37 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |