C20H24N3O3S+ — CID 9286647
2-[4-[2-(2-methylphenoxy)ethyl]piperazin-4-ium-1-yl]sulfonylbenzonitrile (PubChem CID 9286647) has the molecular formula C20H24N3O3S+ and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-[4-[2-(2-methylphenoxy)ethyl]piperazin-4-ium-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[2-(2-methylphenoxy)ethyl]piperazin-4-ium-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 9286647 |
| Molecular Formula | C20H24N3O3S+ |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-[4-[2-(2-methylphenoxy)ethyl]piperazin-4-ium-1-yl]sulfonylbenzonitrile |
| SMILES | Cc1ccccc1OCC[NH+]1CCN(S(=O)(=O)c2ccccc2C#N)CC1 |
| InChI | InChI=1S/C20H23N3O3S/c1-17-6-2-4-8-19(17)26-15-14-22-10-12-23(13-11-22)27(24,25)20-9-5-3-7-18(20)16-21/h2-9H,10-15H2,1H3/p+1 |
| InChIKey | MTWOORNFYZCWTN-UHFFFAOYSA-O |
| XLogP | 0.83 |
| TPSA | 74.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |