C10H11BrN2O3 — CID 106669648
(5-bromo-3-pyridinyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone (PubChem CID 106669648) has the molecular formula C10H11BrN2O3 and a molecular weight of 287.11 g/mol. Its IUPAC name is (5-bromo-3-pyridinyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone.
| Compound Name | (5-bromo-3-pyridinyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 106669648 |
| Molecular Formula | C10H11BrN2O3 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | (5-bromo-3-pyridinyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cncc(Br)c1)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C10H11BrN2O3/c11-7-1-6(2-12-3-7)10(16)13-4-8(14)9(15)5-13/h1-3,8-9,14-15H,4-5H2 |
| InChIKey | IANHVXVFMAQCFQ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |