C12H16BrN3O — CID 63873857
(5-bromo-3-pyridinyl)-(3,5-dimethylpiperazin-1-yl)methanone (PubChem CID 63873857) has the molecular formula C12H16BrN3O and a molecular weight of 298.18 g/mol. Its IUPAC name is (5-bromo-3-pyridinyl)-(3,5-dimethylpiperazin-1-yl)methanone.
| Compound Name | (5-bromo-3-pyridinyl)-(3,5-dimethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 63873857 |
| Molecular Formula | C12H16BrN3O |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | (5-bromo-3-pyridinyl)-(3,5-dimethylpiperazin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2cncc(Br)c2)CC(C)N1 |
| InChI | InChI=1S/C12H16BrN3O/c1-8-6-16(7-9(2)15-8)12(17)10-3-11(13)5-14-4-10/h3-5,8-9,15H,6-7H2,1-2H3 |
| InChIKey | DOANKRWWPXYYJE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |