C21H22N3O3S+ — CID 9181394
2-prop-2-enyl-5-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-carbonyl]isoindole-1,3-dione (PubChem CID 9181394) has the molecular formula C21H22N3O3S+ and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-prop-2-enyl-5-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-prop-2-enyl-5-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 9181394 |
| Molecular Formula | C21H22N3O3S+ |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-prop-2-enyl-5-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-carbonyl]isoindole-1,3-dione |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)N3CC[NH+](Cc4ccsc4)CC3)cc2C1=O |
| InChI | InChI=1S/C21H21N3O3S/c1-2-6-24-20(26)17-4-3-16(12-18(17)21(24)27)19(25)23-9-7-22(8-10-23)13-15-5-11-28-14-15/h2-5,11-12,14H,1,6-10,13H2/p+1 |
| InChIKey | ZHPOPGGXDFEQDR-UHFFFAOYSA-O |
| XLogP | 1.07 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|