C27H27Cl2N5S — CID 3260110
3-[N-(2-cyanoethyl)-4-[[4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]methyl]anilino]propanenitrile (PubChem CID 3260110) has the molecular formula C27H27Cl2N5S and a molecular weight of 524.52 g/mol. Its IUPAC name is 3-[N-(2-cyanoethyl)-4-[[4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]methyl]anilino]propanenitrile.
| Compound Name | 3-[N-(2-cyanoethyl)-4-[[4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]methyl]anilino]propanenitrile |
|---|---|
| PubChem CID | 3260110 |
| Molecular Formula | C27H27Cl2N5S |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 3-[N-(2-cyanoethyl)-4-[[4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]methyl]anilino]propanenitrile |
| SMILES | N#CCCN(CCC#N)c1ccc(CN2CCC(c3nc(-c4ccc(Cl)c(Cl)c4)cs3)CC2)cc1 |
| InChI | InChI=1S/C27H27Cl2N5S/c28-24-8-5-22(17-25(24)29)26-19-35-27(32-26)21-9-15-33(16-10-21)18-20-3-6-23(7-4-20)34(13-1-11-30)14-2-12-31/h3-8,17,19,21H,1-2,9-10,13-16,18H2 |
| InChIKey | UPUOGCNMGUVKDL-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 66.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|