C21H24Cl2N2O2S — CID 3743735
ethyl 4-[4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-3-methylbut-2-enoate (PubChem CID 3743735) has the molecular formula C21H24Cl2N2O2S and a molecular weight of 439.41 g/mol. Its IUPAC name is ethyl 4-[4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | ethyl 4-[4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 3743735 |
| Molecular Formula | C21H24Cl2N2O2S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | ethyl 4-[4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-3-methylbut-2-enoate |
| SMILES | CCOC(=O)C=C(C)CN1CCC(c2nc(-c3ccc(Cl)c(Cl)c3)cs2)CC1 |
| InChI | InChI=1S/C21H24Cl2N2O2S/c1-3-27-20(26)10-14(2)12-25-8-6-15(7-9-25)21-24-19(13-28-21)16-4-5-17(22)18(23)11-16/h4-5,10-11,13,15H,3,6-9,12H2,1-2H3 |
| InChIKey | LSMXDQDLXVYFIG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|