C26H39N3S — CID 44622127
N,N-dimethyl-2-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]ethanamine (PubChem CID 44622127) has the molecular formula C26H39N3S and a molecular weight of 425.69 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]ethanamine.
| Compound Name | N,N-dimethyl-2-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]ethanamine |
|---|---|
| PubChem CID | 44622127 |
| Molecular Formula | C26H39N3S |
| Molecular Weight | 425.69 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | N,N-dimethyl-2-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]ethanamine |
| SMILES | CN(C)CCN1CCC(c2nc(-c3ccc4c(c3)C(C)(C)CCC4(C)C)cs2)CC1 |
| InChI | InChI=1S/C26H39N3S/c1-25(2)11-12-26(3,4)22-17-20(7-8-21(22)25)23-18-30-24(27-23)19-9-13-29(14-10-19)16-15-28(5)6/h7-8,17-19H,9-16H2,1-6H3 |
| InChIKey | MSZSKVQIBDXDRU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.69 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |