C27H40N2S — CID 143916769
2-(1-hexylpiperidin-4-yl)-4-(1,1,3,3-tetramethyl-2H-inden-5-yl)-1,3-thiazole (PubChem CID 143916769) has the molecular formula C27H40N2S and a molecular weight of 424.70 g/mol. Its IUPAC name is 2-(1-hexylpiperidin-4-yl)-4-(1,1,3,3-tetramethyl-2H-inden-5-yl)-1,3-thiazole.
| Compound Name | 2-(1-hexylpiperidin-4-yl)-4-(1,1,3,3-tetramethyl-2H-inden-5-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 143916769 |
| Molecular Formula | C27H40N2S |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.29 |
| IUPAC Name | 2-(1-hexylpiperidin-4-yl)-4-(1,1,3,3-tetramethyl-2H-inden-5-yl)-1,3-thiazole |
| SMILES | CCCCCCN1CCC(c2nc(-c3ccc4c(c3)C(C)(C)CC4(C)C)cs2)CC1 |
| InChI | InChI=1S/C27H40N2S/c1-6-7-8-9-14-29-15-12-20(13-16-29)25-28-24(18-30-25)21-10-11-22-23(17-21)27(4,5)19-26(22,2)3/h10-11,17-18,20H,6-9,12-16,19H2,1-5H3 |
| InChIKey | ZGVXVGFENCZUHV-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|