C26H38N2OS — CID 123516451
2-methyl-3-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]propan-1-ol (PubChem CID 123516451) has the molecular formula C26H38N2OS and a molecular weight of 426.67 g/mol. Its IUPAC name is 2-methyl-3-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]propan-1-ol.
| Compound Name | 2-methyl-3-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 123516451 |
| Molecular Formula | C26H38N2OS |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 2-methyl-3-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]propan-1-ol |
| SMILES | CC(CO)CN1CCC(c2nc(-c3ccc4c(c3)C(C)(C)CCC4(C)C)cs2)CC1 |
| InChI | InChI=1S/C26H38N2OS/c1-18(16-29)15-28-12-8-19(9-13-28)24-27-23(17-30-24)20-6-7-21-22(14-20)26(4,5)11-10-25(21,2)3/h6-7,14,17-19,29H,8-13,15-16H2,1-5H3 |
| InChIKey | LEJZFHRKDCSMQX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |