C29H42N2O2S — CID 143916684
5-methoxy-4-methyl-1-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]pentan-1-one (PubChem CID 143916684) has the molecular formula C29H42N2O2S and a molecular weight of 482.73 g/mol. Its IUPAC name is 5-methoxy-4-methyl-1-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]pentan-1-one.
| Compound Name | 5-methoxy-4-methyl-1-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 143916684 |
| Molecular Formula | C29H42N2O2S |
| Molecular Weight | 482.73 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | 5-methoxy-4-methyl-1-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]pentan-1-one |
| SMILES | COCC(C)CCC(=O)N1CCC(c2nc(-c3ccc4c(c3)C(C)(C)CCC4(C)C)cs2)CC1 |
| InChI | InChI=1S/C29H42N2O2S/c1-20(18-33-6)7-10-26(32)31-15-11-21(12-16-31)27-30-25(19-34-27)22-8-9-23-24(17-22)29(4,5)14-13-28(23,2)3/h8-9,17,19-21H,7,10-16,18H2,1-6H3 |
| InChIKey | UKQJSCLIMGJGTH-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.73 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |