C34H50N2O4S — CID 58246448
tert-butyl (3S)-7-hydroxy-3-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidine-1-carbonyl]heptanoate (PubChem CID 58246448) has the molecular formula C34H50N2O4S and a molecular weight of 582.85 g/mol. Its IUPAC name is tert-butyl (3S)-7-hydroxy-3-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidine-1-carbonyl]heptanoate.
| Compound Name | tert-butyl (3S)-7-hydroxy-3-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidine-1-carbonyl]heptanoate |
|---|---|
| PubChem CID | 58246448 |
| Molecular Formula | C34H50N2O4S |
| Molecular Weight | 582.85 g/mol |
| Exact Mass | 582.35 |
| IUPAC Name | tert-butyl (3S)-7-hydroxy-3-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidine-1-carbonyl]heptanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](CCCCO)C(=O)N1CCC(c2nc(-c3ccc4c(c3)C(C)(C)CCC4(C)C)cs2)CC1 |
| InChI | InChI=1S/C34H50N2O4S/c1-32(2,3)40-29(38)21-25(10-8-9-19-37)31(39)36-17-13-23(14-18-36)30-35-28(22-41-30)24-11-12-26-27(20-24)34(6,7)16-15-33(26,4)5/h11-12,20,22-23,25,37H,8-10,13-19,21H2,1-7H3/t25-/m0/s1 |
| InChIKey | UYWICXUJFBGSND-VWLOTQADSA-N |
| XLogP | 7.38 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.85 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|