C31H39N3OS — CID 58246479
4-pyridin-2-yl-1-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]butan-1-one (PubChem CID 58246479) has the molecular formula C31H39N3OS and a molecular weight of 501.74 g/mol. Its IUPAC name is 4-pyridin-2-yl-1-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]butan-1-one.
| Compound Name | 4-pyridin-2-yl-1-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 58246479 |
| Molecular Formula | C31H39N3OS |
| Molecular Weight | 501.74 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | 4-pyridin-2-yl-1-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]butan-1-one |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3csc(C4CCN(C(=O)CCCc5ccccn5)CC4)n3)ccc21 |
| InChI | InChI=1S/C31H39N3OS/c1-30(2)15-16-31(3,4)26-20-23(11-12-25(26)30)27-21-36-29(33-27)22-13-18-34(19-14-22)28(35)10-7-9-24-8-5-6-17-32-24/h5-6,8,11-12,17,20-22H,7,9-10,13-16,18-19H2,1-4H3 |
| InChIKey | CRCNRTWWNVOASL-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.74 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |