C31H45N3O4S — CID 163877884
tert-butyl N-[3-hydroxy-2-methyl-1-oxo-1-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]propan-2-yl]carbamate (PubChem CID 163877884) has the molecular formula C31H45N3O4S and a molecular weight of 555.79 g/mol. Its IUPAC name is tert-butyl N-[3-hydroxy-2-methyl-1-oxo-1-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-hydroxy-2-methyl-1-oxo-1-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 163877884 |
| Molecular Formula | C31H45N3O4S |
| Molecular Weight | 555.79 g/mol |
| Exact Mass | 555.31 |
| IUPAC Name | tert-butyl N-[3-hydroxy-2-methyl-1-oxo-1-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(CO)C(=O)N1CCC(c2nc(-c3ccc4c(c3)C(C)(C)CCC4(C)C)cs2)CC1 |
| InChI | InChI=1S/C31H45N3O4S/c1-28(2,3)38-27(37)33-31(8,19-35)26(36)34-15-11-20(12-16-34)25-32-24(18-39-25)21-9-10-22-23(17-21)30(6,7)14-13-29(22,4)5/h9-10,17-18,20,35H,11-16,19H2,1-8H3,(H,33,37) |
| InChIKey | PQNFBPDXUTXMBK-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.79 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |