C33H47N3O5S — CID 45107901
tert-butyl 2-[[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidine-1-carbonyl]oxymethyl]morpholine-4-carboxylate (PubChem CID 45107901) has the molecular formula C33H47N3O5S and a molecular weight of 597.82 g/mol. Its IUPAC name is tert-butyl 2-[[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidine-1-carbonyl]oxymethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidine-1-carbonyl]oxymethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 45107901 |
| Molecular Formula | C33H47N3O5S |
| Molecular Weight | 597.82 g/mol |
| Exact Mass | 597.32 |
| IUPAC Name | tert-butyl 2-[[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidine-1-carbonyl]oxymethyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOC(COC(=O)N2CCC(c3nc(-c4ccc5c(c4)C(C)(C)CCC5(C)C)cs3)CC2)C1 |
| InChI | InChI=1S/C33H47N3O5S/c1-31(2,3)41-30(38)36-16-17-39-24(19-36)20-40-29(37)35-14-10-22(11-15-35)28-34-27(21-42-28)23-8-9-25-26(18-23)33(6,7)13-12-32(25,4)5/h8-9,18,21-22,24H,10-17,19-20H2,1-7H3 |
| InChIKey | RLQNGRVDHFNHKU-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 81.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.82 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |