C26H36N4O2S — CID 45107664
3-amino-4-oxo-4-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]butanamide (PubChem CID 45107664) has the molecular formula C26H36N4O2S and a molecular weight of 468.67 g/mol. Its IUPAC name is 3-amino-4-oxo-4-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]butanamide.
| Compound Name | 3-amino-4-oxo-4-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]butanamide |
|---|---|
| PubChem CID | 45107664 |
| Molecular Formula | C26H36N4O2S |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 3-amino-4-oxo-4-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]butanamide |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3csc(C4CCN(C(=O)C(N)CC(N)=O)CC4)n3)ccc21 |
| InChI | InChI=1S/C26H36N4O2S/c1-25(2)9-10-26(3,4)19-13-17(5-6-18(19)25)21-15-33-23(29-21)16-7-11-30(12-8-16)24(32)20(27)14-22(28)31/h5-6,13,15-16,20H,7-12,14,27H2,1-4H3,(H2,28,31) |
| InChIKey | AEJJDGAMTFLWFB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |