C32H41N3OS — CID 143916682
5-pyridin-2-yl-1-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]pentan-1-one (PubChem CID 143916682) has the molecular formula C32H41N3OS and a molecular weight of 515.77 g/mol. Its IUPAC name is 5-pyridin-2-yl-1-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]pentan-1-one.
| Compound Name | 5-pyridin-2-yl-1-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 143916682 |
| Molecular Formula | C32H41N3OS |
| Molecular Weight | 515.77 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | 5-pyridin-2-yl-1-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]pentan-1-one |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3csc(C4CCN(C(=O)CCCCc5ccccn5)CC4)n3)ccc21 |
| InChI | InChI=1S/C32H41N3OS/c1-31(2)16-17-32(3,4)27-21-24(12-13-26(27)31)28-22-37-30(34-28)23-14-19-35(20-15-23)29(36)11-6-5-9-25-10-7-8-18-33-25/h7-8,10,12-13,18,21-23H,5-6,9,11,14-17,19-20H2,1-4H3 |
| InChIKey | GVAIXVIPBJPSIP-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.77 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|