C33H46N4OS — CID 163533283
N'-(2-methoxyphenyl)-N-[2-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]ethane-1,2-diamine (PubChem CID 163533283) has the molecular formula C33H46N4OS and a molecular weight of 546.83 g/mol. Its IUPAC name is N'-(2-methoxyphenyl)-N-[2-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]ethane-1,2-diamine.
| Compound Name | N'-(2-methoxyphenyl)-N-[2-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 163533283 |
| Molecular Formula | C33H46N4OS |
| Molecular Weight | 546.83 g/mol |
| Exact Mass | 546.34 |
| IUPAC Name | N'-(2-methoxyphenyl)-N-[2-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]ethane-1,2-diamine |
| SMILES | COc1ccccc1NCCNCCN1CCC(c2nc(-c3ccc4c(c3)C(C)(C)CCC4(C)C)cs2)CC1 |
| InChI | InChI=1S/C33H46N4OS/c1-32(2)14-15-33(3,4)27-22-25(10-11-26(27)32)29-23-39-31(36-29)24-12-19-37(20-13-24)21-18-34-16-17-35-28-8-6-7-9-30(28)38-5/h6-11,22-24,34-35H,12-21H2,1-5H3 |
| InChIKey | DUUJRHBNHAOWAB-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.83 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|