C10H14N2 — CID 59694806
CID 59694806 (PubChem CID 59694806) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol.
| Compound Name | CID 59694806 |
|---|---|
| PubChem CID | 59694806 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | — |
| SMILES | [CH]C1CCN(Cc2ccc[nH]2)C1 |
| InChI | InChI=1S/C10H14N2/c1-9-4-6-12(7-9)8-10-3-2-5-11-10/h1-3,5,9,11H,4,6-8H2 |
| InChIKey | PMKXNCLOMFWUSL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |