C20H23N3OS — CID 175689875
3-[[1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]-thiophen-3-ylamino]phenol (PubChem CID 175689875) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is 3-[[1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]-thiophen-3-ylamino]phenol.
| Compound Name | 3-[[1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]-thiophen-3-ylamino]phenol |
|---|---|
| PubChem CID | 175689875 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 3-[[1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]-thiophen-3-ylamino]phenol |
| SMILES | Oc1cccc(N(c2ccsc2)C2CCN(Cc3ccc[nH]3)CC2)c1 |
| InChI | InChI=1S/C20H23N3OS/c24-20-5-1-4-18(13-20)23(19-8-12-25-15-19)17-6-10-22(11-7-17)14-16-3-2-9-21-16/h1-5,8-9,12-13,15,17,21,24H,6-7,10-11,14H2 |
| InChIKey | HTEPZFLGEBPSQS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 42.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |