C13H22N2 — CID 138507717
2-[(3,4-diethylpyrrolidin-1-yl)methyl]-1H-pyrrole (PubChem CID 138507717) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-[(3,4-diethylpyrrolidin-1-yl)methyl]-1H-pyrrole.
| Compound Name | 2-[(3,4-diethylpyrrolidin-1-yl)methyl]-1H-pyrrole |
|---|---|
| PubChem CID | 138507717 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 2-[(3,4-diethylpyrrolidin-1-yl)methyl]-1H-pyrrole |
| SMILES | CCC1CN(Cc2ccc[nH]2)CC1CC |
| InChI | InChI=1S/C13H22N2/c1-3-11-8-15(9-12(11)4-2)10-13-6-5-7-14-13/h5-7,11-12,14H,3-4,8-10H2,1-2H3 |
| InChIKey | KKBGYWVVRGRGMU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |