C21H21F3N2O — CID 143813368
(3R,4R)-1-benzyl-4-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoxy]pyrrolidin-3-amine (PubChem CID 143813368) has the molecular formula C21H21F3N2O and a molecular weight of 374.41 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-4-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoxy]pyrrolidin-3-amine.
| Compound Name | (3R,4R)-1-benzyl-4-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoxy]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 143813368 |
| Molecular Formula | C21H21F3N2O |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (3R,4R)-1-benzyl-4-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoxy]pyrrolidin-3-amine |
| SMILES | N[C@@H]1CN(Cc2ccccc2)C[C@H]1OCC#Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H21F3N2O/c22-21(23,24)18-10-8-16(9-11-18)7-4-12-27-20-15-26(14-19(20)25)13-17-5-2-1-3-6-17/h1-3,5-6,8-11,19-20H,12-15,25H2/t19-,20-/m1/s1 |
| InChIKey | UPDCDDYDQOQIAM-WOJBJXKFSA-N |
| XLogP | 3.29 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|