C22H27N — CID 166708556
(1S,5R)-3-benzyl-6-(3-tert-butylphenyl)-3-azabicyclo[3.1.0]hexane (PubChem CID 166708556) has the molecular formula C22H27N and a molecular weight of 305.47 g/mol. Its IUPAC name is (1S,5R)-3-benzyl-6-(3-tert-butylphenyl)-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,5R)-3-benzyl-6-(3-tert-butylphenyl)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 166708556 |
| Molecular Formula | C22H27N |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | (1S,5R)-3-benzyl-6-(3-tert-butylphenyl)-3-azabicyclo[3.1.0]hexane |
| SMILES | CC(C)(C)c1cccc(C2[C@H]3CN(Cc4ccccc4)C[C@@H]23)c1 |
| InChI | InChI=1S/C22H27N/c1-22(2,3)18-11-7-10-17(12-18)21-19-14-23(15-20(19)21)13-16-8-5-4-6-9-16/h4-12,19-21H,13-15H2,1-3H3/t19-,20+,21? |
| InChIKey | FMAUUNQVBLRDAQ-WCRBZPEASA-N |
| XLogP | 4.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |