C20H33N — CID 153484507
4-tert-butyl-1-[(3-tert-butylphenyl)methyl]piperidine (PubChem CID 153484507) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is 4-tert-butyl-1-[(3-tert-butylphenyl)methyl]piperidine.
| Compound Name | 4-tert-butyl-1-[(3-tert-butylphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 153484507 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | 4-tert-butyl-1-[(3-tert-butylphenyl)methyl]piperidine |
| SMILES | CC(C)(C)c1cccc(CN2CCC(C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C20H33N/c1-19(2,3)17-10-12-21(13-11-17)15-16-8-7-9-18(14-16)20(4,5)6/h7-9,14,17H,10-13,15H2,1-6H3 |
| InChIKey | GASLAGXSYNJZSG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |