About 4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline
4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline (PubChem CID 82841493) has the molecular formula C16H24Cl2N2
and a molecular weight of 315.29 g/mol. Its IUPAC name is 4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline.
Molecular Properties
| Compound Name | 4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline |
| PubChem CID | 82841493 |
| Molecular Formula | C16H24Cl2N2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline |
| SMILES | CC(C)(C)C1CCN(Cc2cc(Cl)c(N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H24Cl2N2/c1-16(2,3)12-4-6-20(7-5-12)10-11-8-13(17)15(19)14(18)9-11/h8-9,12H,4-7,10,19H2,1-3H3 |
| InChIKey | MEERGIDUSMMFQW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline?
The IUPAC name of 4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline (CID 82841493) is 4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline.
What is the SMILES notation for 4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline?
The canonical SMILES for 4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline is CC(C)(C)C1CCN(Cc2cc(Cl)c(N)c(Cl)c2)CC1.
What is the InChIKey of 4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline?
The InChIKey is MEERGIDUSMMFQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24Cl2N2/c1-16(2,3)12-4-6-20(7-5-12)10-11-8-13(17)15(19)14(18)9-11/h8-9,12H,4-7,10,19H2,1-3H3.
What are the key properties of 4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline?
4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline has a molecular weight of 315.29 g/mol, XLogP of 4.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline is sourced from PubChem (CID 82841493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).