C16H24Cl2N2 — CID 82841493
4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline (PubChem CID 82841493) has the molecular formula C16H24Cl2N2 and a molecular weight of 315.29 g/mol. Its IUPAC name is 4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline.
| Compound Name | 4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline |
|---|---|
| PubChem CID | 82841493 |
| Molecular Formula | C16H24Cl2N2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-[(4-tert-butylpiperidin-1-yl)methyl]-2,6-dichloroaniline |
| SMILES | CC(C)(C)C1CCN(Cc2cc(Cl)c(N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H24Cl2N2/c1-16(2,3)12-4-6-20(7-5-12)10-11-8-13(17)15(19)14(18)9-11/h8-9,12H,4-7,10,19H2,1-3H3 |
| InChIKey | MEERGIDUSMMFQW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|