C22H38N2O — CID 166564880
4-[(4-tert-butylpiperidin-1-yl)methyl]-N-methyl-N-[(2-methylpropan-2-yl)oxymethyl]aniline (PubChem CID 166564880) has the molecular formula C22H38N2O and a molecular weight of 346.56 g/mol. Its IUPAC name is 4-[(4-tert-butylpiperidin-1-yl)methyl]-N-methyl-N-[(2-methylpropan-2-yl)oxymethyl]aniline.
| Compound Name | 4-[(4-tert-butylpiperidin-1-yl)methyl]-N-methyl-N-[(2-methylpropan-2-yl)oxymethyl]aniline |
|---|---|
| PubChem CID | 166564880 |
| Molecular Formula | C22H38N2O |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.30 |
| IUPAC Name | 4-[(4-tert-butylpiperidin-1-yl)methyl]-N-methyl-N-[(2-methylpropan-2-yl)oxymethyl]aniline |
| SMILES | CN(COC(C)(C)C)c1ccc(CN2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C22H38N2O/c1-21(2,3)19-12-14-24(15-13-19)16-18-8-10-20(11-9-18)23(7)17-25-22(4,5)6/h8-11,19H,12-17H2,1-7H3 |
| InChIKey | VYLIBXKXDAECGT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|