C25H37NOSi — CID 69177639
tert-butyl-[(1,4-dibenzylpyrrolidin-3-yl)methoxy]-dimethylsilane (PubChem CID 69177639) has the molecular formula C25H37NOSi and a molecular weight of 395.66 g/mol. Its IUPAC name is tert-butyl-[(1,4-dibenzylpyrrolidin-3-yl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1,4-dibenzylpyrrolidin-3-yl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 69177639 |
| Molecular Formula | C25H37NOSi |
| Molecular Weight | 395.66 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | tert-butyl-[(1,4-dibenzylpyrrolidin-3-yl)methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CN(Cc2ccccc2)CC1Cc1ccccc1 |
| InChI | InChI=1S/C25H37NOSi/c1-25(2,3)28(4,5)27-20-24-19-26(17-22-14-10-7-11-15-22)18-23(24)16-21-12-8-6-9-13-21/h6-15,23-24H,16-20H2,1-5H3 |
| InChIKey | UFFYFIRXDCNRNO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|