C25H28N2 — CID 90744168
N-[[(3S,4S)-1,4-dibenzylpyrrolidin-3-yl]methyl]aniline (PubChem CID 90744168) has the molecular formula C25H28N2 and a molecular weight of 356.51 g/mol. Its IUPAC name is N-[[(3S,4S)-1,4-dibenzylpyrrolidin-3-yl]methyl]aniline.
| Compound Name | N-[[(3S,4S)-1,4-dibenzylpyrrolidin-3-yl]methyl]aniline |
|---|---|
| PubChem CID | 90744168 |
| Molecular Formula | C25H28N2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | N-[[(3S,4S)-1,4-dibenzylpyrrolidin-3-yl]methyl]aniline |
| SMILES | c1ccc(C[C@@H]2CN(Cc3ccccc3)C[C@@H]2CNc2ccccc2)cc1 |
| InChI | InChI=1S/C25H28N2/c1-4-10-21(11-5-1)16-23-19-27(18-22-12-6-2-7-13-22)20-24(23)17-26-25-14-8-3-9-15-25/h1-15,23-24,26H,16-20H2/t23-,24+/m1/s1 |
| InChIKey | JHANUGBHDQEJGZ-RPWUZVMVSA-N |
| XLogP | 5.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |