C17H20N2O — CID 59394921
(3R,4R)-4-anilino-1-benzylpyrrolidin-3-ol (PubChem CID 59394921) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (3R,4R)-4-anilino-1-benzylpyrrolidin-3-ol.
| Compound Name | (3R,4R)-4-anilino-1-benzylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 59394921 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (3R,4R)-4-anilino-1-benzylpyrrolidin-3-ol |
| SMILES | O[C@@H]1CN(Cc2ccccc2)C[C@H]1Nc1ccccc1 |
| InChI | InChI=1S/C17H20N2O/c20-17-13-19(11-14-7-3-1-4-8-14)12-16(17)18-15-9-5-2-6-10-15/h1-10,16-18,20H,11-13H2/t16-,17-/m1/s1 |
| InChIKey | UHXFTLICDFHTGJ-IAGOWNOFSA-N |
| XLogP | 2.34 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |