C25H30N2O3 — CID 70294835
(3R,4R,5R)-1-benzyl-5-(hydroxymethyl)piperidine-3,4-diol;N-phenylaniline (PubChem CID 70294835) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is (3R,4R,5R)-1-benzyl-5-(hydroxymethyl)piperidine-3,4-diol;N-phenylaniline.
| Compound Name | (3R,4R,5R)-1-benzyl-5-(hydroxymethyl)piperidine-3,4-diol;N-phenylaniline |
|---|---|
| PubChem CID | 70294835 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (3R,4R,5R)-1-benzyl-5-(hydroxymethyl)piperidine-3,4-diol;N-phenylaniline |
| SMILES | OC[C@H]1CN(Cc2ccccc2)C[C@@H](O)[C@@H]1O.c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C13H19NO3.C12H11N/c15-9-11-7-14(8-12(16)13(11)17)6-10-4-2-1-3-5-10;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-5,11-13,15-17H,6-9H2;1-10,13H/t11-,12-,13-;/m1./s1 |
| InChIKey | CLPPEECSZLENTF-NLPVPVDASA-N |
| XLogP | 3.26 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |