C19H24N2O — CID 67312130
(3S,4S)-1-benzyl-4-(2-methylanilino)piperidin-3-ol (PubChem CID 67312130) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-4-(2-methylanilino)piperidin-3-ol.
| Compound Name | (3S,4S)-1-benzyl-4-(2-methylanilino)piperidin-3-ol |
|---|---|
| PubChem CID | 67312130 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | (3S,4S)-1-benzyl-4-(2-methylanilino)piperidin-3-ol |
| SMILES | Cc1ccccc1N[C@H]1CCN(Cc2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C19H24N2O/c1-15-7-5-6-10-17(15)20-18-11-12-21(14-19(18)22)13-16-8-3-2-4-9-16/h2-10,18-20,22H,11-14H2,1H3/t18-,19-/m0/s1 |
| InChIKey | GTIZLMAWVMOXFD-OALUTQOASA-N |
| XLogP | 3.04 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |