C15H24N2O — CID 24783882
(3R,4R)-1-benzyl-4-(butylamino)pyrrolidin-3-ol (PubChem CID 24783882) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-4-(butylamino)pyrrolidin-3-ol.
| Compound Name | (3R,4R)-1-benzyl-4-(butylamino)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 24783882 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | (3R,4R)-1-benzyl-4-(butylamino)pyrrolidin-3-ol |
| SMILES | CCCCN[C@@H]1CN(Cc2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C15H24N2O/c1-2-3-9-16-14-11-17(12-15(14)18)10-13-7-5-4-6-8-13/h4-8,14-16,18H,2-3,9-12H2,1H3/t14-,15-/m1/s1 |
| InChIKey | ISJCQNLBAKJDQT-HUUCEWRRSA-N |
| XLogP | 1.62 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|