About methyl 4-[[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]amino]benzoate
methyl 4-[[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]amino]benzoate (PubChem CID 24783887) has the molecular formula C19H22N2O3
and a molecular weight of 326.40 g/mol. Its IUPAC name is methyl 4-[[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]amino]benzoate.
Molecular Properties
| Compound Name | methyl 4-[[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]amino]benzoate |
| PubChem CID | 24783887 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | methyl 4-[[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(N[C@@H]2CN(Cc3ccccc3)C[C@H]2O)cc1 |
| InChI | InChI=1S/C19H22N2O3/c1-24-19(23)15-7-9-16(10-8-15)20-17-12-21(13-18(17)22)11-14-5-3-2-4-6-14/h2-10,17-18,20,22H,11-13H2,1H3/t17-,18-/m1/s1 |
| InChIKey | MICPDHSKROFSLP-QZTJIDSGSA-N |
| XLogP | 2.13 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]amino]benzoate?
The IUPAC name of methyl 4-[[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]amino]benzoate (CID 24783887) is methyl 4-[[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]amino]benzoate.
What is the SMILES notation for methyl 4-[[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]amino]benzoate?
The canonical SMILES for methyl 4-[[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]amino]benzoate is COC(=O)c1ccc(N[C@@H]2CN(Cc3ccccc3)C[C@H]2O)cc1.
What is the InChIKey of methyl 4-[[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]amino]benzoate?
The InChIKey is MICPDHSKROFSLP-QZTJIDSGSA-N. The full InChI is InChI=1S/C19H22N2O3/c1-24-19(23)15-7-9-16(10-8-15)20-17-12-21(13-18(17)22)11-14-5-3-2-4-6-14/h2-10,17-18,20,22H,11-13H2,1H3/t17-,18-/m1/s1.
What are the key properties of methyl 4-[[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]amino]benzoate?
methyl 4-[[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]amino]benzoate has a molecular weight of 326.40 g/mol, XLogP of 2.13, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]amino]benzoate is sourced from PubChem (CID 24783887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).