About N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline
N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline (PubChem CID 59272034) has the molecular formula C31H32N2
and a molecular weight of 432.61 g/mol. Its IUPAC name is N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline.
Molecular Properties
| Compound Name | N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline |
| PubChem CID | 59272034 |
| Molecular Formula | C31H32N2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline |
| SMILES | c1ccc(C[C@H]2CN(Cc3ccccc3)C[C@@H]2CN(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H32N2/c1-5-13-26(14-6-1)21-28-23-32(22-27-15-7-2-8-16-27)24-29(28)25-33(30-17-9-3-10-18-30)31-19-11-4-12-20-31/h1-20,28-29H,21-25H2/t28-,29+/m0/s1 |
| InChIKey | JNIPZKVYRFLNIY-URLMMPGGSA-N |
| XLogP | 6.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline?
The IUPAC name of N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline (CID 59272034) is N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline.
What is the SMILES notation for N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline?
The canonical SMILES for N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline is c1ccc(C[C@H]2CN(Cc3ccccc3)C[C@@H]2CN(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline?
The InChIKey is JNIPZKVYRFLNIY-URLMMPGGSA-N. The full InChI is InChI=1S/C31H32N2/c1-5-13-26(14-6-1)21-28-23-32(22-27-15-7-2-8-16-27)24-29(28)25-33(30-17-9-3-10-18-30)31-19-11-4-12-20-31/h1-20,28-29H,21-25H2/t28-,29+/m0/s1.
What are the key properties of N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline?
N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline has a molecular weight of 432.61 g/mol, XLogP of 6.82, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline is sourced from PubChem (CID 59272034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).