C31H32N2 — CID 59272034
N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline (PubChem CID 59272034) has the molecular formula C31H32N2 and a molecular weight of 432.61 g/mol. Its IUPAC name is N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline.
| Compound Name | N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline |
|---|---|
| PubChem CID | 59272034 |
| Molecular Formula | C31H32N2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | N-[[(3R,4R)-1,4-dibenzylpyrrolidin-3-yl]methyl]-N-phenylaniline |
| SMILES | c1ccc(C[C@H]2CN(Cc3ccccc3)C[C@@H]2CN(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H32N2/c1-5-13-26(14-6-1)21-28-23-32(22-27-15-7-2-8-16-27)24-29(28)25-33(30-17-9-3-10-18-30)31-19-11-4-12-20-31/h1-20,28-29H,21-25H2/t28-,29+/m0/s1 |
| InChIKey | JNIPZKVYRFLNIY-URLMMPGGSA-N |
| XLogP | 6.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |