C24H34N2O3Si — CID 68917211
[(3R,4S)-1-benzyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 68917211) has the molecular formula C24H34N2O3Si and a molecular weight of 426.63 g/mol. Its IUPAC name is [(3R,4S)-1-benzyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,4S)-1-benzyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 68917211 |
| Molecular Formula | C24H34N2O3Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | [(3R,4S)-1-benzyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CN(Cc2ccccc2)C[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H34N2O3Si/c1-24(2,3)30(4,5)29-18-21-16-25(15-19-9-7-6-8-10-19)17-23(21)20-11-13-22(14-12-20)26(27)28/h6-14,21,23H,15-18H2,1-5H3/t21-,23-/m1/s1 |
| InChIKey | BLFFJAWWWYWEJP-FYYLOGMGSA-N |
| XLogP | 5.83 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|