C22H23N3O3 — CID 120769358
[(3R,4R)-1-[[5-(4-nitrophenyl)furan-2-yl]methyl]-4-phenylpyrrolidin-3-yl]methanamine (PubChem CID 120769358) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is [(3R,4R)-1-[[5-(4-nitrophenyl)furan-2-yl]methyl]-4-phenylpyrrolidin-3-yl]methanamine.
| Compound Name | [(3R,4R)-1-[[5-(4-nitrophenyl)furan-2-yl]methyl]-4-phenylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 120769358 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | [(3R,4R)-1-[[5-(4-nitrophenyl)furan-2-yl]methyl]-4-phenylpyrrolidin-3-yl]methanamine |
| SMILES | NC[C@@H]1CN(Cc2ccc(-c3ccc([N+](=O)[O-])cc3)o2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H23N3O3/c23-12-18-13-24(15-21(18)16-4-2-1-3-5-16)14-20-10-11-22(28-20)17-6-8-19(9-7-17)25(26)27/h1-11,18,21H,12-15,23H2/t18-,21+/m1/s1 |
| InChIKey | VYRBENJUXOIJLR-NQIIRXRSSA-N |
| XLogP | 4.03 |
| TPSA | 85.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|