C19H24ClN3O2 — CID 120760160
[(3R,4R)-1-[2-(4-nitrophenyl)ethyl]-4-phenylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120760160) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is [(3R,4R)-1-[2-(4-nitrophenyl)ethyl]-4-phenylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [(3R,4R)-1-[2-(4-nitrophenyl)ethyl]-4-phenylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120760160 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | [(3R,4R)-1-[2-(4-nitrophenyl)ethyl]-4-phenylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | Cl.NC[C@@H]1CN(CCc2ccc([N+](=O)[O-])cc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H23N3O2.ClH/c20-12-17-13-21(14-19(17)16-4-2-1-3-5-16)11-10-15-6-8-18(9-7-15)22(23)24;/h1-9,17,19H,10-14,20H2;1H/t17-,19+;/m1./s1 |
| InChIKey | BTYIYBJVXCLOGD-ZFNKBKEPSA-N |
| XLogP | 3.23 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|